3,6-Dimethyl-2,4-dioxocyclohexane-1-carboxylic acid methyl ester structure
|
Common Name | 3,6-Dimethyl-2,4-dioxocyclohexane-1-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 61710-85-8 | Molecular Weight | 198.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3,6-dimethyl-2,4-dioxocyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14O4 |
|---|---|
| Molecular Weight | 198.21600 |
| Exact Mass | 198.08900 |
| PSA | 60.44000 |
| LogP | 0.58970 |
| InChIKey | DLSXDJHNHAKETI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C(=O)C(C)C(=O)CC1C |
| HS Code | 2918300090 |
|---|
|
~%
3,6-Dimethyl-2,... CAS#:61710-85-8 |
| Literature: Sonn Chemische Berichte, 1929 , vol. 62, p. 3015 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 2,4-dioxo-3,6-dimethylcyclohexane carboxylate |
| 3,6-dimethyl-2,4-dioxo-cyclohexanecarboxylic acid methyl ester |
| 3,6-Dimethyl-2,4-dioxo-cyclohexancarbonsaeure-methylester |
| methyl 3,6-dimethylcyclohexane-2,4-dione carboxylate |
| Cyclohexanecarboxylic acid,3,6-dimethyl-2,4-dioxo-,methyl ester |