2,4-dinitro-7,9-bis(trichloromethyl)-8,10-dioxabicyclo[4.4.0]deca-2,4,11-triene structure
|
Common Name | 2,4-dinitro-7,9-bis(trichloromethyl)-8,10-dioxabicyclo[4.4.0]deca-2,4,11-triene | ||
|---|---|---|---|---|
| CAS Number | 61720-09-0 | Molecular Weight | 460.86700 | |
| Density | 1.89g/cm3 | Boiling Point | 505.5ºC at 760 mmHg | |
| Molecular Formula | C10H4Cl6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.5ºC | |
| Name | 6,8-dinitro-2,4-bis(trichloromethyl)-4H-1,3-benzodioxine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 505.5ºC at 760 mmHg |
| Molecular Formula | C10H4Cl6N2O6 |
| Molecular Weight | 460.86700 |
| Flash Point | 259.5ºC |
| Exact Mass | 457.82000 |
| PSA | 110.10000 |
| LogP | 6.06600 |
| Index of Refraction | 1.639 |
| InChIKey | FHFYDARLLMBMPK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)OC(C(Cl)(Cl)Cl)OC2C(Cl)(Cl)Cl |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,8-dinitro-2,4-bis(trichloromethyl)-1,3-benzdioxin |
| 6,8-dinitro-2,4-bis-trichloromethyl-4H-benzo[1,3]dioxin |
| 6,8-Dinitro-2,4-bis-trichlormethyl-4H-benzo[1,3]dioxin |