[(2-chloroacetyl)amino]-phenylmethoxy-phosphinic acid structure
|
Common Name | [(2-chloroacetyl)amino]-phenylmethoxy-phosphinic acid | ||
|---|---|---|---|---|
| CAS Number | 61727-67-1 | Molecular Weight | 263.61500 | |
| Density | 1.431g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11ClNO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-chloroacetyl)-phenylmethoxyphosphonamidic acid |
|---|
| Density | 1.431g/cm3 |
|---|---|
| Molecular Formula | C9H11ClNO4P |
| Molecular Weight | 263.61500 |
| Exact Mass | 263.01100 |
| PSA | 85.44000 |
| LogP | 2.04950 |
| Index of Refraction | 1.554 |
| InChIKey | NGRGDALKMDYKNY-UHFFFAOYSA-N |
| SMILES | O=C(CCl)NP(=O)(O)OCc1ccccc1 |
|
~%
[(2-chloroacety... CAS#:61727-67-1 |
| Literature: Glover,G.I. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 452 - 453 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |