(4-hexylphenyl) 4-(4-heptylphenyl)benzoate
(4-hexylphenyl) 4-(4-heptylphenyl)benzoate structure
|
Common Name | (4-hexylphenyl) 4-(4-heptylphenyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 61733-24-2 | Molecular Weight | 456.65900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H40O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (4-Hexylphenyl) 4-(4-heptylphenyl)benzoate, CAS号61733-24-2, molecular formula C32H40O2, molecular weight 456.65900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-hexylphenyl) 4-(4-heptylphenyl)benzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C32H40O2 |
|---|---|
| Molecular Weight | 456.65900 |
| Exact Mass | 456.30300 |
| PSA | 26.30000 |
| LogP | 9.20850 |
| InChIKey | RIJOYWMIWUYZMH-UHFFFAOYSA-N |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(CCCCCC)cc3)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(4-hexylphenyl)... CAS#:61733-24-2 |
| Literature: Merck Patent: FR2288732DE2450088 , 19761976 ; Chem.Abstr., 1976 , vol. 85, # 46219 |
|
~%
(4-hexylphenyl)... CAS#:61733-24-2 |
| Literature: Merck Patent: DE2535046 , 1977 ; Chem.Abstr., 1977 , vol. 86, # 189552 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [1,1'-Biphenyl]-4-carboxylic acid,4'-heptyl-,4-hexylphenyl ester |
| 4-(4-n-heptylphenyl)-benzoic acid 4'-n-hexylphenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: LogP of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is 9.20850. |
| Q: What is the InChIKey of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: InChIKey of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is RIJOYWMIWUYZMH-UHFFFAOYSA-N. |
| Q: What English synonyms does (4-hexylphenyl) 4-(4-heptylphenyl)benzoate have? |
| A: English synonyms of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate: [1,1'-Biphenyl]-4-carboxylic acid,4'-heptyl-,4-hexylphenyl ester, 4-(4-n-heptylphenyl)-benzoic acid 4'-n-hexylphenyl ester. |
| Q: What is the molecular weight of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: Molecular weight of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is 456.65900. |
| Q: What is the English name of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: The English name of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is (4-hexylphenyl) 4-(4-heptylphenyl)benzoate. |
| Q: What is the SMILES notation of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: SMILES notation of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is CCCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(CCCCCC)cc3)cc2)cc1. |
| Q: What is the molecular formula of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: Molecular formula of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is C32H40O2. |
| Q: What is the CAS number of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: CAS number of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is 61733-24-2. |
| Q: What is the polar surface area (PSA) of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate? |
| A: Polar surface area (PSA) of (4-hexylphenyl) 4-(4-heptylphenyl)benzoate is 26.30000. |
| Q: What is the Chinese name of 61733-24-2? |
| A: Chinese name of 61733-24-2 is 61733-24-2. |