dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate
![dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate Structure](https://image.chemsrc.com/caspic/183/61736-76-3.png)
dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate structure
|
Common Name | dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 61736-76-3 | Molecular Weight | 212.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate (English name), CAS number 61736-76-3, molecular formula C10H12O5, molecular weight 212.19900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12O5 |
|---|---|
| Molecular Weight | 212.19900 |
| Exact Mass | 212.06800 |
| PSA | 61.83000 |
| LogP | 0.39530 |
| InChIKey | YZMNQBBFSSOZOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C=COC1(C(=O)OC)CC2 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Oxabicyclo[3.2.0]hept-3-ene-1,5-dicarboxylic acid,dimethyl ester |
| Oxa-bicyclo[3.2.0]hepten-diester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: InChIKey of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is YZMNQBBFSSOZOZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: Molecular formula of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is C10H12O5. |
| Q: What is the molecular weight of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: Molecular weight of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is 212.19900. |
| Q: What is the LogP of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: LogP of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is 0.39530. |
| Q: What is the polar surface area (PSA) of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: Polar surface area (PSA) of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is 61.83000. |
| Q: What is the English name of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: The English name of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate. |
| Q: What is the CAS number of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: CAS number of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is 61736-76-3. |
| Q: What is the SMILES notation of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate? |
| A: SMILES notation of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate is COC(=O)C12C=COC1(C(=O)OC)CC2. |
| Q: What English synonyms does dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate have? |
| A: English synonyms of dimethyl 4-oxabicyclo[3.2.0]hept-2-ene-1,5-dicarboxylate: 2-Oxabicyclo[3.2.0]hept-3-ene-1,5-dicarboxylic acid,dimethyl ester, Oxa-bicyclo[3.2.0]hepten-diester. |
| Q: What is the Chinese name of 61736-76-3? |
| A: Chinese name of 61736-76-3 is 61736-76-3. |