butyl 3,4,5-trimethoxybenzoate
Modify Date: 2025-08-27 12:52:02
butyl 3,4,5-trimethoxybenzoate structure
|
Common Name | butyl 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 6178-46-7 | Molecular Weight | 268.30600 | |
| Density | 1.078g/cm3 | Boiling Point | 325.3ºC at 760 mmHg | |
| Molecular Formula | C14H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.5ºC | |
| Name | butyl 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.078g/cm3 |
|---|---|
| Boiling Point | 325.3ºC at 760 mmHg |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.30600 |
| Flash Point | 138.5ºC |
| Exact Mass | 268.13100 |
| PSA | 53.99000 |
| LogP | 2.66930 |
| Index of Refraction | 1.49 |
| InChIKey | GZRFAUJVAXSXMI-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1cc(OC)c(OC)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
butyl 3,4,5-tri... CAS#:6178-46-7 |
| Literature: Sarbhai,K.P.; Mathur,K.B.L. Indian Journal of Chemistry, 1966 , vol. 4, p. 81 - 85 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,3,4,5-trimethoxy-,butyl ester |
| 3.4.5-Trimethoxy-benzoesaeure-butylester |
| EINECS 228-226-7 |