1-(5-chloro-2,4-dinitrophenyl)piperidine structure
|
Common Name | 1-(5-chloro-2,4-dinitrophenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 61785-79-3 | Molecular Weight | 285.68400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-chloro-2,4-dinitrophenyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12ClN3O4 |
|---|---|
| Molecular Weight | 285.68400 |
| Exact Mass | 285.05200 |
| PSA | 94.88000 |
| LogP | 4.25810 |
| InChIKey | LDZJAUJVUYRWFC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCCCC2)cc1Cl |
|
~%
1-(5-chloro-2,4... CAS#:61785-79-3 |
| Literature: Borsche; Bahr Justus Liebigs Annalen der Chemie, 1913 , vol. 402, p. 108 |
|
~%
1-(5-chloro-2,4... CAS#:61785-79-3 |
| Literature: Le Fevre; Turner Journal of the Chemical Society, 1927 , p. 1117 |
| 1-(5-Chlor-2,4-dinitro-phenyl)-piperidin |
| 1-(5-chloro-2,4-dinitro-phenyl)-piperidine |
| Piperidine,1-(5-chloro-2,4-dinitrophenyl) |