1,8-Dinitro-4,5-bis(2,4-dinitrophenoxy)anthraquinone
Modify Date: 2025-09-13 13:33:05
1,8-Dinitro-4,5-bis(2,4-dinitrophenoxy)anthraquinone structure
|
Common Name | 1,8-Dinitro-4,5-bis(2,4-dinitrophenoxy)anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 61792-00-5 | Molecular Weight | 662.38800 | |
| Density | 1.784g/cm3 | Boiling Point | 814ºC at 760 mmHg | |
| Molecular Formula | C26H10N6O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.6ºC | |
| Name | 1,8-bis(2,4-dinitrophenoxy)-4,5-dinitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.784g/cm3 |
|---|---|
| Boiling Point | 814ºC at 760 mmHg |
| Molecular Formula | C26H10N6O16 |
| Molecular Weight | 662.38800 |
| Flash Point | 312.6ºC |
| Exact Mass | 662.01500 |
| PSA | 327.52000 |
| LogP | 8.63500 |
| Index of Refraction | 1.747 |
| InChIKey | ZJSTXLBMDBNFRO-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc([N+](=O)[O-])c2C(=O)c2c([N+](=O)[O-])ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c21 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 9,10-Anthracenedione,1,8-bis(2,4-dinitrophenoxy)-4,5-dinitro |
| 1,8-Bis-(2,4-dinitro-phenoxy)-4,5-dinitro-anthrachinon |
| 1,8-Bis(2,4-dinitrophenoxy)-4,5-dinitroanthraquinone |