butan-2-yl 2-(2,4,5-trichlorophenoxy)acetate structure
|
Common Name | butan-2-yl 2-(2,4,5-trichlorophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 61792-07-2 | Molecular Weight | 311.58900 | |
| Density | 1.322g/cm3 | Boiling Point | 366.2ºC at 760 mmHg | |
| Molecular Formula | C12H13Cl3O3 | Melting Point | 39°C | |
| MSDS | N/A | Flash Point | 139.1ºC | |
| Name | butan-2-yl 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760 mmHg |
| Melting Point | 39°C |
| Molecular Formula | C12H13Cl3O3 |
| Molecular Weight | 311.58900 |
| Flash Point | 139.1ºC |
| Exact Mass | 309.99300 |
| PSA | 35.53000 |
| LogP | 4.36730 |
| Index of Refraction | 1.527 |
| InChIKey | KOCPUBZALOBLTB-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| RIDADR | UN 2765 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4,5-T sec-butyl ester |