1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate)
Modify Date: 2026-07-09 05:36:25
1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) structure
|
Common Name | 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 618-72-4 | Molecular Weight | 322.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9F3N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9F3N2O6 |
|---|---|
| Molecular Weight | 322.19 |
| InChIKey | JZACWXVQBUPSSV-UHFFFAOYSA-N |
| SMILES | O=C(OCCCC(F)(F)F)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate)? |
| A: SMILES notation of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) is O=C(OCCCC(F)(F)F)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1. |
| Q: What is the CAS number of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate)? |
| A: CAS number of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) is 618-72-4. |
| Q: What is the InChIKey of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate)? |
| A: InChIKey of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) is JZACWXVQBUPSSV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate)? |
| A: Molecular formula of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) is C11H9F3N2O6. |
| Q: What is the English name of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate)? |
| A: The English name of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) is 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate). |
| Q: What is the molecular weight of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate)? |
| A: Molecular weight of 1-Butanol, 4,4,4-trifluoro-, 1-(3,5-dinitrobenzoate) is 322.19. |
| Q: What is the Chinese name of 618-72-4? |
| A: Chinese name of 618-72-4 is 618-72-4. |