5,7-Dimethoxy-3-methyl-1-indanone structure
|
Common Name | 5,7-Dimethoxy-3-methyl-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 618084-59-6 | Molecular Weight | 206.238 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 343.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.6±14.3 °C | |
| Name | 5,7-Dimethoxy-3-methyl-2,3-dihydro-1H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.2±42.0 °C at 760 mmHg |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Flash Point | 152.6±14.3 °C |
| Exact Mass | 206.094299 |
| PSA | 35.53000 |
| LogP | 2.76 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | ZMSPOUREAWGXSO-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(c1)C(C)CC2=O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,7-dimethoxy-3-methyl-2,3-dihydroinden-1-one |
| 5,7-Dimethoxy-3-methyl-1-indanone |
| 1H-Inden-1-one, 2,3-dihydro-5,7-dimethoxy-3-methyl- |