Carnitine methyl ester chloride
Modify Date: 2026-07-13 14:02:41
Carnitine methyl ester chloride structure
|
Common Name | Carnitine methyl ester chloride | ||
|---|---|---|---|---|
| CAS Number | 61809-71-0 | Molecular Weight | 211.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Carnitine methyl ester chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H18ClNO3 |
|---|---|
| Molecular Weight | 211.68 |
| InChIKey | YJVCQYNMHROJMW-OGFXRTJISA-M |
| SMILES | COC(=O)CC(O)C[N+](C)(C)C.[Cl-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Carnitine methyl ester chloride? |
| A: Molecular weight of Carnitine methyl ester chloride is 211.68. |
| Q: What is the InChIKey of Carnitine methyl ester chloride? |
| A: InChIKey of Carnitine methyl ester chloride is YJVCQYNMHROJMW-OGFXRTJISA-M. |
| Q: What is the Chinese name of 61809-71-0? |
| A: Chinese name of 61809-71-0 is 61809-71-0. |
| Q: What is the CAS number of Carnitine methyl ester chloride? |
| A: CAS number of Carnitine methyl ester chloride is 61809-71-0. |
| Q: What is the SMILES notation of Carnitine methyl ester chloride? |
| A: SMILES notation of Carnitine methyl ester chloride is COC(=O)CC(O)C[N+](C)(C)C.[Cl-]. |
| Q: What is the molecular formula of Carnitine methyl ester chloride? |
| A: Molecular formula of Carnitine methyl ester chloride is C8H18ClNO3. |
| Q: What is the English name of Carnitine methyl ester chloride? |
| A: The English name of Carnitine methyl ester chloride is Carnitine methyl ester chloride. |