manganese(2+) heptanoate
Modify Date: 2024-09-17 12:25:07
manganese(2+) heptanoate structure
|
Common Name | manganese(2+) heptanoate | ||
|---|---|---|---|---|
| CAS Number | 61810-04-6 | Molecular Weight | 313.29200 | |
| Density | N/A | Boiling Point | 222.6ºC at 760 mmHg | |
| Molecular Formula | C14H26MnO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.2ºC | |
| Name | heptanoate,manganese(2+) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 222.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H26MnO4 |
| Molecular Weight | 313.29200 |
| Flash Point | 99.2ºC |
| Exact Mass | 313.12100 |
| PSA | 80.26000 |
| LogP | 1.41340 |
| InChIKey | NJUDPVIWMUMPLJ-UHFFFAOYSA-L |
| SMILES | CCCCCCC(=O)[O-].CCCCCCC(=O)[O-].[Mn+2] |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| manganese(2+) diheptanoate |
| EINECS 263-236-5 |
| Manganese heptanoate |
| Manganous heptanoate |
| Manganese(2+) heptanoate |
| Heptanoic acid,manganese(2+) salt |
| Heptanoic acid,manganese(2+) salt (2:1) |