Voriconazole N-oxide structure
|
Common Name | Voriconazole N-oxide | ||
|---|---|---|---|---|
| CAS Number | 618109-05-0 | Molecular Weight | 365.31 | |
| Density | 1.473g/cm3 | Boiling Point | 569.513ºC at 760 mmHg | |
| Molecular Formula | C16H14F3N5O2 | Melting Point | 75-77ºC | |
| MSDS | N/A | Flash Point | 298.231ºC | |
Use of Voriconazole N-oxideVoriconazole N-oxide (Voriconazole oxynitride) is a potent antifungal agent. Voriconazole N-oxide has phototoxicity and photocarcinogenicity. Voriconazole N-oxide does not sensitize keratinocytes to ultraviolet B (UVB)[1]. |
| Name | (2R,3S)-2-(2,4-difluorophenyl)-3-(5-fluoro-1-oxidopyrimidin-1-ium-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Voriconazole N-oxide (Voriconazole oxynitride) is a potent antifungal agent. Voriconazole N-oxide has phototoxicity and photocarcinogenicity. Voriconazole N-oxide does not sensitize keratinocytes to ultraviolet B (UVB)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.473g/cm3 |
|---|---|
| Boiling Point | 569.513ºC at 760 mmHg |
| Melting Point | 75-77ºC |
| Molecular Formula | C16H14F3N5O2 |
| Molecular Weight | 365.31 |
| Flash Point | 298.231ºC |
| Exact Mass | 365.11000 |
| PSA | 89.29000 |
| LogP | 2.21040 |
| Index of Refraction | 1.622 |
| InChIKey | KPLFPLUCFPRUHU-MGPLVRAMSA-N |
| SMILES | CC(c1nc[n+]([O-])cc1F)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| Voriconazole N-Oxide |
| (|AR,|AS)-|A-(2,4-Difluorophenyl)-5-fluoro-|A-methyl-|A-(1H-1,2,4-triazol-1-ylmethyl)-1-oxide-4-pyrimidineethanol |