4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-naphthalen-2-ylbenzamide
Modify Date: 2025-08-26 16:46:54
![4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-naphthalen-2-ylbenzamide Structure](https://image.chemsrc.com/caspic/176/6182-82-7.png)
4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-naphthalen-2-ylbenzamide structure
|
Common Name | 4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-naphthalen-2-ylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 6182-82-7 | Molecular Weight | 464.96400 | |
| Density | 1.391g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H21ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-naphthalen-2-ylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.391g/cm3 |
|---|---|
| Molecular Formula | C25H21ClN2O3S |
| Molecular Weight | 464.96400 |
| Exact Mass | 464.09600 |
| PSA | 74.86000 |
| LogP | 6.86550 |
| Index of Refraction | 1.698 |
| InChIKey | NKWCRDALVAYWOL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(Cc1ccc(Cl)cc1)c1ccc(C(=O)Nc2ccc3ccccc3c2)cc1 |
|
~%
4-[(4-chlorophe... CAS#:6182-82-7 |
| Literature: Oya; Matsumoto; Takashina; Iwao; Funae Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 63 - 70 |
|
~%
4-[(4-chlorophe... CAS#:6182-82-7 |
| Literature: Oya; Matsumoto; Takashina; Iwao; Funae Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 63 - 70 |
| 4-[(4-chlorobenzyl)(methylsulfonyl)amino]-N-(naphthalen-2-yl)benzamide |