hexyl octyl phthalate
Modify Date: 2025-09-16 18:24:28
hexyl octyl phthalate structure
|
Common Name | hexyl octyl phthalate | ||
|---|---|---|---|---|
| CAS Number | 61827-62-1 | Molecular Weight | 362.50300 | |
| Density | 0.997g/cm3 | Boiling Point | 396.9ºC at 760 mmHg | |
| Molecular Formula | C22H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.3ºC | |
| Name | 1-O-hexyl 2-O-octyl benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.997g/cm3 |
|---|---|
| Boiling Point | 396.9ºC at 760 mmHg |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.50300 |
| Flash Point | 211.3ºC |
| Exact Mass | 362.24600 |
| PSA | 52.60000 |
| LogP | 5.94100 |
| Index of Refraction | 1.491 |
| InChIKey | LZCTXAGBGKLUBX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCC |
| HS Code | 2917349000 |
|---|
| HS Code | 2917349000 |
|---|---|
| Summary | 2917349000 other esters of orthophthalic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Phthalic acid,hexyl octyl ester |
| Hexyl octyl phthalate |
| EINECS 263-255-9 |