1,2-bis(3-methylbuta-1,2-dienyl)benzene
1,2-bis(3-methylbuta-1,2-dienyl)benzene structure
|
Common Name | 1,2-bis(3-methylbuta-1,2-dienyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 61838-63-9 | Molecular Weight | 210.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-bis(3-methylbuta-1,2-dienyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18 |
|---|---|
| Molecular Weight | 210.31400 |
| Exact Mass | 210.14100 |
| LogP | 4.84320 |
| InChIKey | LPIUSLSFARWCNG-UHFFFAOYSA-N |
| SMILES | CC(C)=C=Cc1ccccc1C=C=C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
1,2-bis(3-methy... CAS#:61838-63-9 |
| Literature: Braverman, Samuel; Duar, Ytzhak Journal of the American Chemical Society, 1990 , vol. 112, # 15 p. 5830 - 5837 |
|
~%
1,2-bis(3-methy... CAS#:61838-63-9 |
| Literature: Hoehn, Juergen; Weyerstahl, Peter Chemische Berichte, 1983 , vol. 116, # 2 p. 808 - 814 |
|
~95%
1,2-bis(3-methy... CAS#:61838-63-9 |
| Literature: Hoehn, Juergen; Weyerstahl, Peter Chemische Berichte, 1983 , vol. 116, # 2 p. 808 - 814 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,1,2-bis(3-methyl-1,2-butadienyl) |
| 1,2-Bis(3-methyl-1,2-butadienyl)benzol |
| 1,2-bis(3-methyl-1,2-butadienyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 61838-63-9? |
| A: Chinese name of 61838-63-9 is 61838-63-9. |
| Q: What is the InChIKey of 1,2-bis(3-methylbuta-1,2-dienyl)benzene? |
| A: InChIKey of 1,2-bis(3-methylbuta-1,2-dienyl)benzene is LPIUSLSFARWCNG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,2-bis(3-methylbuta-1,2-dienyl)benzene? |
| A: Molecular formula of 1,2-bis(3-methylbuta-1,2-dienyl)benzene is C16H18. |
| Q: What is the SMILES notation of 1,2-bis(3-methylbuta-1,2-dienyl)benzene? |
| A: SMILES notation of 1,2-bis(3-methylbuta-1,2-dienyl)benzene is CC(C)=C=Cc1ccccc1C=C=C(C)C. |
| Q: What is the English name of 1,2-bis(3-methylbuta-1,2-dienyl)benzene? |
| A: The English name of 1,2-bis(3-methylbuta-1,2-dienyl)benzene is 1,2-bis(3-methylbuta-1,2-dienyl)benzene. |
| Q: What is the molecular weight of 1,2-bis(3-methylbuta-1,2-dienyl)benzene? |
| A: Molecular weight of 1,2-bis(3-methylbuta-1,2-dienyl)benzene is 210.31400. |
| Q: What English synonyms does 1,2-bis(3-methylbuta-1,2-dienyl)benzene have? |
| A: English synonyms of 1,2-bis(3-methylbuta-1,2-dienyl)benzene: Benzene,1,2-bis(3-methyl-1,2-butadienyl), 1,2-Bis(3-methyl-1,2-butadienyl)benzol, 1,2-bis(3-methyl-1,2-butadienyl)benzene. |
| Q: What is the CAS number of 1,2-bis(3-methylbuta-1,2-dienyl)benzene? |
| A: CAS number of 1,2-bis(3-methylbuta-1,2-dienyl)benzene is 61838-63-9. |
| Q: What is the LogP of 1,2-bis(3-methylbuta-1,2-dienyl)benzene? |
| A: LogP of 1,2-bis(3-methylbuta-1,2-dienyl)benzene is 4.84320. |