Sorbinicate structure
|
Common Name | Sorbinicate | ||
|---|---|---|---|---|
| CAS Number | 6184-06-1 | Molecular Weight | 812.73600 | |
| Density | N/A | Boiling Point | 965.5ºC at 760 mmHg | |
| Molecular Formula | C42H32N6O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 537.7ºC | |
Use of SorbinicateSorbinicate, a derivative of nicotinic acid, exerts a favourable influence on blood rheology and platelet function[1]. |
| Name | 2,3,4,5,6-pentakis(pyridine-3-carbonyloxy)hexyl pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Sorbinicate, a derivative of nicotinic acid, exerts a favourable influence on blood rheology and platelet function[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 965.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C42H32N6O12 |
| Molecular Weight | 812.73600 |
| Flash Point | 537.7ºC |
| Exact Mass | 812.20800 |
| PSA | 235.14000 |
| LogP | 3.97280 |
| InChIKey | IMRLNFKFNFLWQF-UHFFFAOYSA-N |
| SMILES | O=C(OCC(OC(=O)c1cccnc1)C(OC(=O)c1cccnc1)C(OC(=O)c1cccnc1)C(COC(=O)c1cccnc1)OC(=O)c1cccnc1)c1cccnc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Sorbinicate |
| Sorbinicato |
| Sorbinicato [INN-Spanish] |
| meso-Inositol-hexynicotinat |
| 1,2,3,4,5,6-hexakis-o-(pyridin-3-ylcarbonyl)hexitol |
| Glucitol hexanicotinate |
| Mannit-hexanicotinat |
| Sorbinicatum |
| Sorbinicatum [INN-Latin] |