1,2,3,4,5-pentafluoro-6-propan-2-yloxybenzene
Modify Date: 2025-11-25 12:21:33
1,2,3,4,5-pentafluoro-6-propan-2-yloxybenzene structure
|
Common Name | 1,2,3,4,5-pentafluoro-6-propan-2-yloxybenzene | ||
|---|---|---|---|---|
| CAS Number | 61874-51-9 | Molecular Weight | 226.14300 | |
| Density | 1.347g/cm3 | Boiling Point | 179ºC at 760 mmHg | |
| Molecular Formula | C9H7F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 68.4ºC | |
| Name | 1,2,3,4,5-pentafluoro-6-propan-2-yloxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 179ºC at 760 mmHg |
| Molecular Formula | C9H7F5O |
| Molecular Weight | 226.14300 |
| Flash Point | 68.4ºC |
| Exact Mass | 226.04200 |
| PSA | 9.23000 |
| LogP | 3.16930 |
| Index of Refraction | 1.415 |
| InChIKey | APQBSUNGPSYRQX-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Pentafluorphenyl-isopropyl-ether |
| Benzene,pentafluoro(1-methylethoxy) |
| iso-propoxy pentafluorobenzene |
| 1-isopropoxypentafluorobenzene |