N-(1-adamantyl)pyridine-2-carboxamide structure
|
Common Name | N-(1-adamantyl)pyridine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 61876-32-2 | Molecular Weight | 256.34300 | |
| Density | 1.19g/cm3 | Boiling Point | 466.7ºC at 760 mmHg | |
| Molecular Formula | C16H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
Summary: N-(1-adamantyl)pyridine-2-carboxamide, CAS number 61876-32-2, molecular formula C16H20N2O, molecular weight 256.34300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(1-adamantyl)pyridine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 466.7ºC at 760 mmHg |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.34300 |
| Flash Point | 236.1ºC |
| Exact Mass | 256.15800 |
| PSA | 45.48000 |
| LogP | 3.35500 |
| Index of Refraction | 1.598 |
| InChIKey | KDPXTORXIBWFOA-UHFFFAOYSA-N |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~86%
N-(1-adamantyl)... CAS#:61876-32-2 |
| Literature: Morimoto, Hiroyuki; Fujiwara, Risa; Shimizu, Yuhei; Morisaki, Kazuhiro; Ohshima, Takashi Organic Letters, 2014 , vol. 16, # 7 p. 2018 - 2021 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(adamantan-1-yl)picolinamide |
| 2-Pyridinecarboxamide,N-tricyclo(3.3.1.1(sup 3,7))dec-1-yl |
| pyridine-2-carboxylic acid adamantan-1-ylamide |
| N-(1-Adamantyl)picolinamide |
| Picolinamide,N-(1-adamantyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: Boiling point of N-(1-adamantyl)pyridine-2-carboxamide is 466.7ºC at 760 mmHg. |
| Q: What is the molecular weight of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: Molecular weight of N-(1-adamantyl)pyridine-2-carboxamide is 256.34300. |
| Q: What is the English name of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: The English name of N-(1-adamantyl)pyridine-2-carboxamide is N-(1-adamantyl)pyridine-2-carboxamide. |
| Q: What is the LogP of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: LogP of N-(1-adamantyl)pyridine-2-carboxamide is 3.35500. |
| Q: What is the polar surface area (PSA) of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: Polar surface area (PSA) of N-(1-adamantyl)pyridine-2-carboxamide is 45.48000. |
| Q: What English synonyms does N-(1-adamantyl)pyridine-2-carboxamide have? |
| A: English synonyms of N-(1-adamantyl)pyridine-2-carboxamide: N-(adamantan-1-yl)picolinamide, 2-Pyridinecarboxamide,N-tricyclo(3.3.1.1(sup 3,7))dec-1-yl, pyridine-2-carboxylic acid adamantan-1-ylamide, N-(1-Adamantyl)picolinamide, Picolinamide,N-(1-adamantyl). |
| Q: What is the molecular formula of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: Molecular formula of N-(1-adamantyl)pyridine-2-carboxamide is C16H20N2O. |
| Q: What is the SMILES notation of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: SMILES notation of N-(1-adamantyl)pyridine-2-carboxamide is O=C(NC12CC3CC(CC(C3)C1)C2)c1ccccn1. |
| Q: What is the CAS number of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: CAS number of N-(1-adamantyl)pyridine-2-carboxamide is 61876-32-2. |
| Q: What is the InChIKey of N-(1-adamantyl)pyridine-2-carboxamide? |
| A: InChIKey of N-(1-adamantyl)pyridine-2-carboxamide is KDPXTORXIBWFOA-UHFFFAOYSA-N. |