2,5-bis(4-bromophenyl)-3,4-dimethylfuran structure
|
Common Name | 2,5-bis(4-bromophenyl)-3,4-dimethylfuran | ||
|---|---|---|---|---|
| CAS Number | 61880-91-9 | Molecular Weight | 406.11100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-bis(4-bromophenyl)-3,4-dimethylfuran |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14Br2O |
|---|---|
| Molecular Weight | 406.11100 |
| Exact Mass | 403.94100 |
| PSA | 13.14000 |
| LogP | 6.75540 |
| InChIKey | MLIDRGUTNXODQB-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2ccc(Br)cc2)oc(-c2ccc(Br)cc2)c1C |
|
~%
2,5-bis(4-bromo... CAS#:61880-91-9 |
| Literature: Couper; Lutz Journal of Organic Chemistry, 1942 , vol. 7, p. 79,84 |
|
~%
Detail
|
| Literature: Couper; Lutz Journal of Organic Chemistry, 1942 , vol. 7, p. 79,84 |
| 2,5-Bis(p-bromphenyl)-3,4-dimethylfuran |
| Furan,2,5-bis(4-bromophenyl)-3,4-dimethyl |
| 2,5-Bis-(4-brom-phenyl)-3,4-dimethyl-furan |
| 2,5-bis-(4-bromo-phenyl)-3,4-dimethyl-furan |