1,5-dimethyl-4-nitro-2H-pyrazol-3-one structure
|
Common Name | 1,5-dimethyl-4-nitro-2H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 61885-22-1 | Molecular Weight | 157.12700 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dimethyl-4-nitro-1H-pyrazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.12700 |
| Exact Mass | 157.04900 |
| PSA | 83.61000 |
| LogP | 0.45320 |
| Index of Refraction | 1.574 |
| InChIKey | NQDGRFWJFDMVPD-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])c(=O)[nH]n1C |
| HS Code | 2933199090 |
|---|
|
~%
1,5-dimethyl-4-... CAS#:61885-22-1 |
| Literature: Krohs Chemische Berichte, 1955 , vol. 88, p. 866,871 |
|
~%
1,5-dimethyl-4-... CAS#:61885-22-1 |
| Literature: Krohs Chemische Berichte, 1955 , vol. 88, p. 866,871 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,5-Dimethyl-4-nitropyrazol-3-on |
| 1,5-dimethyl-4-nitro-1,2-dihydro-pyrazol-3-one |
| 3h-pyrazol-3-one,1,2-dihydro-1,5-dimethyl-4-nitro |