1,5-dimethyl-4-nitro-2H-pyrazol-3-one
1,5-dimethyl-4-nitro-2H-pyrazol-3-one structure
|
Common Name | 1,5-dimethyl-4-nitro-2H-pyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 61885-22-1 | Molecular Weight | 157.12700 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-dimethyl-4-nitro-1H-pyrazol-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.12700 |
| Exact Mass | 157.04900 |
| PSA | 83.61000 |
| LogP | 0.45320 |
| Index of Refraction | 1.574 |
| InChIKey | NQDGRFWJFDMVPD-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])c(=O)[nH]n1C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933199090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,5-dimethyl-4-... CAS#:61885-22-1 |
| Literature: Krohs Chemische Berichte, 1955 , vol. 88, p. 866,871 |
|
~%
1,5-dimethyl-4-... CAS#:61885-22-1 |
| Literature: Krohs Chemische Berichte, 1955 , vol. 88, p. 866,871 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,5-Dimethyl-4-nitropyrazol-3-on |
| 1,5-dimethyl-4-nitro-1,2-dihydro-pyrazol-3-one |
| 3h-pyrazol-3-one,1,2-dihydro-1,5-dimethyl-4-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: Molecular weight of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is 157.12700. |
| Q: What are the upstream materials of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: Related upstream materials(CAS) of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one: 3201-28-3;28022-67-5. |
| Q: What is the molecular formula of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: Molecular formula of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is C5H7N3O3. |
| Q: What is the English name of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: The English name of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is 2,3-dimethyl-4-nitro-1H-pyrazol-5-one. |
| Q: What is the CAS number of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: CAS number of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is 61885-22-1. |
| Q: What is the InChIKey of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: InChIKey of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is NQDGRFWJFDMVPD-UHFFFAOYSA-N. |
| Q: What English synonyms does 2,3-dimethyl-4-nitro-1H-pyrazol-5-one have? |
| A: English synonyms of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one: 1,5-Dimethyl-4-nitropyrazol-3-on, 1,5-dimethyl-4-nitro-1,2-dihydro-pyrazol-3-one, 3h-pyrazol-3-one,1,2-dihydro-1,5-dimethyl-4-nitro. |
| Q: What is the LogP of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: LogP of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is 0.45320. |
| Q: What is the polar surface area (PSA) of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: Polar surface area (PSA) of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is 83.61000. |
| Q: What is the SMILES notation of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one? |
| A: SMILES notation of 2,3-dimethyl-4-nitro-1H-pyrazol-5-one is Cc1c([N+](=O)[O-])c(=O)[nH]n1C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |