3,5-dimethyl-1-nitro-2,4-dioxo-3,5-diazabicyclo[4.1.0]heptane-6-carbonitrile structure
|
Common Name | 3,5-dimethyl-1-nitro-2,4-dioxo-3,5-diazabicyclo[4.1.0]heptane-6-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 61885-23-2 | Molecular Weight | 224.17400 | |
| Density | 1.62g/cm3 | Boiling Point | 419.1ºC at 760 mmHg | |
| Molecular Formula | C8H8N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.3ºC | |
| Name | 2,4-dimethyl-6-nitro-3,5-dioxo-2,4-diazabicyclo[4.1.0]heptane-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 419.1ºC at 760 mmHg |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.17400 |
| Flash Point | 207.3ºC |
| Exact Mass | 224.05500 |
| PSA | 110.23000 |
| Index of Refraction | 1.628 |
| InChIKey | YAIVJIIEVSTRGF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C)C2(C#N)CC2([N+](=O)[O-])C1=O |
|
~%
3,5-dimethyl-1-... CAS#:61885-23-2 |
| Literature: Hirota, Kosaku; Yamada, Yoshihiro; Asao, Tetsuji; Senda, Shigeo Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 1896 - 1899 |
|
~40%
3,5-dimethyl-1-... CAS#:61885-23-2 |
| Literature: Hirota, Kosaku; Yamada, Yoshihiro; Asao, Tetsuji; Senda, Shigeo Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 1896 - 1899 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-cyano-1,3-dimethyl-5-nitro-5,6-dihydrocyclothymine |
| 6-Cyano-1,3-dimethyl-5-nitro-cyclothymin |