tetrahydrogestrinone structure
|
Common Name | tetrahydrogestrinone | ||
|---|---|---|---|---|
| CAS Number | 618903-56-3 | Molecular Weight | 312.44600 | |
| Density | 1.13g/cm3 | Boiling Point | 505.7ºC at 760 mmHg | |
| Molecular Formula | C21H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | (8S,13S,14S,17S)-13,17-diethyl-17-hydroxy-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 505.7ºC at 760 mmHg |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.44600 |
| Flash Point | 214.2ºC |
| Exact Mass | 312.20900 |
| PSA | 37.30000 |
| LogP | 4.49960 |
| Index of Refraction | 1.583 |
| InChIKey | OXHNQTSIKGHVBH-ANULTFPQSA-N |
| SMILES | CCC1(O)CCC2C3CCC4=CC(=O)CCC4=C3C=CC21CC |
|
~79%
tetrahydrogestrinone CAS#:618903-56-3 |
| Literature: Thevis, Mario; Bommerich, Ute; Opfermann, Georg; Schaenzer, Wilhelm Journal of Mass Spectrometry, 2005 , vol. 40, # 4 p. 494 - 502 |
|
~%
tetrahydrogestrinone CAS#:618903-56-3 |
| Literature: Analytical Chemistry, , vol. 79, # 10 p. 3734 - 3740 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 17-HYDROXY-18A-HOMO-19-NOR-17ALPHA-PREGNA-4,9,11-TRIEN-3-ONE |
| BIDD:ER0580 |
| Clear |
| Tetrahydrogestrinone |
| Tetrahydrogestrinone (THG) |
| 17H |