N-(cyclohexylideneamino)benzenesulfonamide structure
|
Common Name | N-(cyclohexylideneamino)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 61892-19-1 | Molecular Weight | 252.33300 | |
| Density | 1.27g/cm3 | Boiling Point | 405.2ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.8ºC | |
| Name | 3-chloro-1-(4-methoxyphenyl)-4-(3-methylanilino)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 405.2ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.33300 |
| Flash Point | 198.8ºC |
| Exact Mass | 252.09300 |
| PSA | 66.91000 |
| LogP | 3.75670 |
| Index of Refraction | 1.607 |
| InChIKey | RXMZCCIBDGAYDU-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(=O)C(Cl)=C(Nc3cccc(C)c3)C2=O)cc1 |
| HS Code | 2935009090 |
|---|
|
~91%
N-(cyclohexylid... CAS#:61892-19-1 |
| Literature: Paquette, Leo A.; Fristad, William E.; Dime, David S.; Bailey, Thomas R. Journal of Organic Chemistry, 1980 , vol. 45, # 15 p. 3017 - 3028 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzolsulfonsaeure-cyclohexylidenhydrazid |
| 3-chloro-1-(4-methoxyphenyl)-4-[(3-methylphenyl)amino]-1h-pyrrole-2,5-dione |
| Cyclohexanon-benzolsulfonylhydrazon |
| benzenesulfonic acid cyclohexylidenehydrazide |
| cyclohexanone benzenesulfonylhydrazone |