3-(4-{2-[Phenyl-(3,4,5-trimethoxy-phenyl)-methoxy]-ethyl}-piperazin-1-yl)-propionic acid; compound with (Z)-but-2-enedioic acid
Modify Date: 2025-09-19 15:57:24
![3-(4-{2-[Phenyl-(3,4,5-trimethoxy-phenyl)-methoxy]-ethyl}-piperazin-1-yl)-propionic acid; compound with (Z)-but-2-enedioic acid Structure](https://image.chemsrc.com/caspic/455/61897-15-2.png)
3-(4-{2-[Phenyl-(3,4,5-trimethoxy-phenyl)-methoxy]-ethyl}-piperazin-1-yl)-propionic acid; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 3-(4-{2-[Phenyl-(3,4,5-trimethoxy-phenyl)-methoxy]-ethyl}-piperazin-1-yl)-propionic acid; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 61897-15-2 | Molecular Weight | 574.61900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H38N2O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-{2-[Phenyl-(3,4,5-trimethoxy-phenyl)-methoxy]-ethyl}-piperazin-1-yl)-propionic acid; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C29H38N2O10 |
|---|---|
| Molecular Weight | 574.61900 |
| Exact Mass | 574.25300 |
| PSA | 155.30000 |
| LogP | 2.49830 |
| InChIKey | ATDGMXQWXZYUES-LVEZLNDCSA-N |
| SMILES | COc1cc(C(OCCN2CCN(CCC(=O)O)CC2)c2ccccc2)cc(OC)c1OC.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |