naphthalen-2-yl N,N-diethylcarbamate structure
|
Common Name | naphthalen-2-yl N,N-diethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 61912-14-9 | Molecular Weight | 243.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalen-2-yl N,N-diethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.30100 |
| Exact Mass | 243.12600 |
| PSA | 29.54000 |
| LogP | 3.68040 |
| InChIKey | SPFHTFNBTUNIJY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)Oc1ccc2ccccc2c1 |
|
~93%
naphthalen-2-yl... CAS#:61912-14-9 |
| Literature: Quasdorf, Kyle W.; Riener, Michelle; Petrova, Krastina V.; Garg, Neil K. Journal of the American Chemical Society, 2009 , vol. 131, # 49 p. 17748 - 17749 |
| F1757-0402 |
| N,N-diethyl-2-naphthyloxycarboxamide |
| 2-naphthyl diethylcarbamate |
| 2-naphthyl N,N-diethyl-O-carbamate |
| 2-naphthalenyl diethylcarbamate |
| Diethyl-carbamic acid naphthalen-2-yl ester |
| naphthalen-2-yl diethylcarbamate |
| diethyl-carbamic acid-[2]naphthyl ester |
| N,N-diethyl-O-naphth-2-yl-carbamate |