3-Methoxy-2,5-dinitro-6-(pentyloxy)benzaldehyde structure
|
Common Name | 3-Methoxy-2,5-dinitro-6-(pentyloxy)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 619314-93-1 | Molecular Weight | 312.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methoxy-2,5-dinitro-6-pentoxybenzaldehyde |
|---|
| Molecular Formula | C13H16N2O7 |
|---|---|
| Molecular Weight | 312.27500 |
| Exact Mass | 312.09600 |
| PSA | 127.17000 |
| LogP | 3.93950 |
| InChIKey | NOYWAZDPBNKLAC-UHFFFAOYSA-N |
| SMILES | CCCCCOc1c([N+](=O)[O-])cc(OC)c([N+](=O)[O-])c1C=O |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |