2-(Hexyloxy)-5-Methoxy-3,6-dinitrobenzaldehyde structure
|
Common Name | 2-(Hexyloxy)-5-Methoxy-3,6-dinitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 619314-94-2 | Molecular Weight | 326.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hexoxy-5-methoxy-3,6-dinitrobenzaldehyde |
|---|
| Molecular Formula | C14H18N2O7 |
|---|---|
| Molecular Weight | 326.30200 |
| Exact Mass | 326.11100 |
| PSA | 127.17000 |
| LogP | 4.32960 |
| InChIKey | KXMLCIDAYYTIOJ-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1c([N+](=O)[O-])cc(OC)c([N+](=O)[O-])c1C=O |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |