1-chloro-3-[1-chloro-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxypropan-2-ol structure
|
Common Name | 1-chloro-3-[1-chloro-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxypropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 61947-78-2 | Molecular Weight | 259.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-3-[1-chloro-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxypropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H20Cl2O3 |
|---|---|
| Molecular Weight | 259.17000 |
| Exact Mass | 258.07900 |
| PSA | 38.69000 |
| LogP | 2.02520 |
| InChIKey | DTFWXGQDSXPIRY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OCC(CCl)OCC(O)CCl |
|
~0%
1-chloro-3-[1-c... CAS#:61947-78-2 |
| Literature: Thuy, Vu Moc; Petit, Huguette; Maitte, Pierre Bulletin des Societes Chimiques Belges, 1982 , vol. 91, # 3 p. 261 - 262 |
|
~%
1-chloro-3-[1-c... CAS#:61947-78-2 |
| Literature: Petrow,V. et al. Journal of Pharmacy and Pharmacology, 1960 , vol. 12, p. 37 - 48 |
| 6-tert.-Butyloxy-1-chlor-5-chlormethyl-2-hydroxy-4-oxahexan |
| 1-(2-tert-butoxy-1-chloromethyl-ethoxy)-3-chloro-propan-2-ol |
| 2-Propanol,1-chloro-3-[2-chloro-1-[(1,1-dimethylethoxy)methyl]ethoxy] |
| 6-tert-Butoxy-1-chlor-5-chlormethyl-2-hydroxy-4-oxahexan |