3-benzyloxy-4-methoxy-6-nitro-benzoic acid
Modify Date: 2025-09-29 11:56:39
3-benzyloxy-4-methoxy-6-nitro-benzoic acid structure
|
Common Name | 3-benzyloxy-4-methoxy-6-nitro-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 61948-83-2 | Molecular Weight | 303.26700 | |
| Density | 1.362g/cm3 | Boiling Point | 504.4ºC at 760mmHg | |
| Molecular Formula | C15H13NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.9ºC | |
| Name | 3-benzyloxy-4-methoxy-6-nitro-benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 504.4ºC at 760mmHg |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.26700 |
| Flash Point | 258.9ºC |
| Exact Mass | 303.07400 |
| PSA | 101.58000 |
| LogP | 3.40380 |
| Index of Refraction | 1.614 |
| InChIKey | HVTHICJFQQKQDW-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C(=O)O)c([N+](=O)[O-])cc1OC |
| HS Code | 2918990090 |
|---|
|
~%
3-benzyloxy-4-m... CAS#:61948-83-2 |
| Literature: Galmarini Anales de la Asociacion Quimica Argentina (1921-2001), 1951 , vol. 39, p. 92,96 |
|
~%
3-benzyloxy-4-m... CAS#:61948-83-2 |
| Literature: Uyeo; Yanaihara Journal of the Chemical Society, 1959 , p. 172,175 |
|
~%
3-benzyloxy-4-m... CAS#:61948-83-2 |
| Literature: Uyeo; Yanaihara Journal of the Chemical Society, 1959 , p. 172,175 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Aethoxy-4-methoxy-2-nitro-benzoesaeure |
| 5-ethoxy-4-methoxy-2-nitro-benzoic acid |