3-chloro-4-nonanoylnaphthalene-1,2-dione structure
|
Common Name | 3-chloro-4-nonanoylnaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 61983-03-7 | Molecular Weight | 332.82100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-4-nonanoylnaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H21ClO3 |
|---|---|
| Molecular Weight | 332.82100 |
| Exact Mass | 332.11800 |
| PSA | 51.21000 |
| LogP | 4.72160 |
| InChIKey | YMKIEOHJXOLDNX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)C1=C(Cl)C(=O)C(=O)c2ccccc21 |
|
~%
3-chloro-4-nona... CAS#:61983-03-7 |
| Literature: Takuwa,A. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 2790 - 2799 |
| 4-Nonanoyl-3-chlor-1,2-naphthochinon |
| 1,2-Naphthalenedione,3-chloro-4-(1-oxononyl) |