1-(3,4-dihydroxynaphthalen-2-yl)butan-1-one structure
|
Common Name | 1-(3,4-dihydroxynaphthalen-2-yl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61983-11-7 | Molecular Weight | 230.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4-dihydroxynaphthalen-2-yl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O3 |
|---|---|
| Molecular Weight | 230.25900 |
| Exact Mass | 230.09400 |
| PSA | 57.53000 |
| LogP | 3.23380 |
| InChIKey | GLPMGWZZNRXIRC-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1cc2ccccc2c(O)c1O |
|
~26%
1-(3,4-dihydrox... CAS#:61983-11-7 |
| Literature: Takuwa; Kai Bulletin of the Chemical Society of Japan, 1990 , vol. 63, # 2 p. 623 - 625 |
| 1-Butanone,1-(3,4-dihydroxy-2-naphthalenyl) |
| 3-Butyryl-naphthalindiol-(1,2) |