1-(7-bromo-3,4-dihydroxynaphthalen-2-yl)heptan-1-one structure
|
Common Name | 1-(7-bromo-3,4-dihydroxynaphthalen-2-yl)heptan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61983-35-5 | Molecular Weight | 351.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(7-bromo-3,4-dihydroxynaphthalen-2-yl)heptan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19BrO3 |
|---|---|
| Molecular Weight | 351.23500 |
| Exact Mass | 350.05200 |
| PSA | 57.53000 |
| LogP | 5.16660 |
| InChIKey | VRJBLPLXXMJBNA-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)c1cc2cc(Br)ccc2c(O)c1O |
|
~%
1-(7-bromo-3,4-... CAS#:61983-35-5 |
| Literature: Takuwa,A. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 2790 - 2799 |
| 3-Heptanoyl-6-brom-naphthalindiol-(1,2) |
| 1-Heptanone,1-(7-bromo-3,4-dihydroxy-2-naphthalenyl) |