5,5-DIMETHYL-3-((3-NITROPHENYL)AMINO)CYCLOHEX-2-EN-1-ONE
5,5-DIMETHYL-3-((3-NITROPHENYL)AMINO)CYCLOHEX-2-EN-1-ONE structure
|
Common Name | 5,5-DIMETHYL-3-((3-NITROPHENYL)AMINO)CYCLOHEX-2-EN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 61997-86-2 | Molecular Weight | 260.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16N2O3 |
|---|---|
| Molecular Weight | 260.28800 |
| Exact Mass | 260.11600 |
| PSA | 74.92000 |
| LogP | 3.87590 |
| InChIKey | AWQCYWVLVFABER-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C=C(Nc2cccc([N+](=O)[O-])c2)C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
5,5-DIMETHYL-3-... CAS#:61997-86-2 |
| Literature: Siddiqui, Zeba N.; Khan, Kulsum; Ahmed, Nayeem Catalysis Letters, 2014 , vol. 144, # 4 p. 623 - 632 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,5-dimethyl-3-(3-nitrophenylamino)-cyclohex-2-enone |
| 3-m-Nitroanilino-5,5-dimethyl-2-cyclohexenon |
| 5,5-DIMETHYL-3-((3-NITROPHENYL)AMINO)CYCLOHEX-2-EN-1-ONE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: LogP of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is 3.87590. |
| Q: What is the English name of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: The English name of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one. |
| Q: What English synonyms does 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one have? |
| A: English synonyms of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one: 5,5-dimethyl-3-(3-nitrophenylamino)-cyclohex-2-enone, 3-m-Nitroanilino-5,5-dimethyl-2-cyclohexenon, 5,5-DIMETHYL-3-((3-NITROPHENYL)AMINO)CYCLOHEX-2-EN-1-ONE. |
| Q: What is the SMILES notation of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: SMILES notation of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is CC1(C)CC(=O)C=C(Nc2cccc([N+](=O)[O-])c2)C1. |
| Q: What is the molecular weight of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: Molecular weight of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is 260.28800. |
| Q: What are the upstream materials of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: Related upstream materials(CAS) of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one: 126-81-8;99-09-2. |
| Q: What is the InChIKey of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: InChIKey of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is AWQCYWVLVFABER-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: CAS number of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is 61997-86-2. |
| Q: What is the molecular formula of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: Molecular formula of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is C14H16N2O3. |
| Q: What is the polar surface area (PSA) of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one? |
| A: Polar surface area (PSA) of 5,5-dimethyl-3-(3-nitroanilino)cyclohex-2-en-1-one is 74.92000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |