[3-(2-hydroxyphenyl)-3-oxopropyl] N,N-dimethylcarbamodithioate structure
|
Common Name | [3-(2-hydroxyphenyl)-3-oxopropyl] N,N-dimethylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 61998-14-9 | Molecular Weight | 269.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(2-hydroxyphenyl)-3-oxopropyl] N,N-dimethylcarbamodithioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO2S2 |
|---|---|
| Molecular Weight | 269.38300 |
| Exact Mass | 269.05400 |
| PSA | 97.93000 |
| LogP | 2.54470 |
| InChIKey | XSVSYQLEVFJTCA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)SCCC(=O)c1ccccc1O |
|
~12%
[3-(2-hydroxyph... CAS#:61998-14-9 |
| Literature: Roman, Gheorghe; Comanita, Eugenia; Dumitrescu, Lucia Phosphorus, Sulfur and Silicon and the Related Elements, 2003 , vol. 178, # 11 p. 2479 - 2490 |
| 2-(o-Hydroxybenzoyl)ethyl dimethyldithiocarbamate |
| S-(3-(2-hydroxyphenyl)-3-oxopropyl) N,N-dimethyldithiocarbamate |
| Carbamodithioic acid,dimethyl-,3-(2-hydroxyphenyl)-3-oxopropyl ester |