6-benzo[1,3]dioxol-5-yl-1,3-dimethyl-pteridine-2,4-dione structure
|
Common Name | 6-benzo[1,3]dioxol-5-yl-1,3-dimethyl-pteridine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 61999-41-5 | Molecular Weight | 312.28000 | |
| Density | 1.457g/cm3 | Boiling Point | 532.3ºC at 760 mmHg | |
| Molecular Formula | C15H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.8ºC | |
| Name | 6-(1,3-benzodioxol-5-yl)-1,3-dimethylpteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.457g/cm3 |
|---|---|
| Boiling Point | 532.3ºC at 760 mmHg |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.28000 |
| Flash Point | 275.8ºC |
| Exact Mass | 312.08600 |
| PSA | 88.24000 |
| LogP | 0.42290 |
| Index of Refraction | 1.643 |
| InChIKey | FWLVPCHOEFHUJK-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2nc(-c3ccc4c(c3)OCO4)cnc2n(C)c1=O |
|
~%
6-benzo[1,3]dio... CAS#:61999-41-5 |
| Literature: Yoneda,F.; Higuchi,M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1336 - 1339 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Aryllumazin |