Thiophosphoric acid O,O-dimethyl O-(m-nitrophenyl) ester structure
|
Common Name | Thiophosphoric acid O,O-dimethyl O-(m-nitrophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 620-29-1 | Molecular Weight | 263.20700 | |
| Density | 1.411g/cm3 | Boiling Point | 319.8ºC at 760 mmHg | |
| Molecular Formula | C8H10NO5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.2ºC | |
| Name | dimethoxy-(3-nitrophenoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 319.8ºC at 760 mmHg |
| Molecular Formula | C8H10NO5PS |
| Molecular Weight | 263.20700 |
| Flash Point | 147.2ºC |
| Exact Mass | 263.00200 |
| PSA | 115.41000 |
| LogP | 3.66470 |
| Index of Refraction | 1.576 |
| InChIKey | DTOLRVVEYZNDCL-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1cccc([N+](=O)[O-])c1 |
| HS Code | 2920190090 |
|---|
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| O,O-Dimethyl O-(3-nitrophenyl) phosphorothioate |
| thiophosphoric acid O,O'-dimethyl ester-O''-(3-nitro-phenyl ester) |
| Thiophosphorsaeure-O,O'-dimethylester-O''-(3-nitro-phenylester) |
| Phosphorothioic acid,O,O-dimethyl O-(m-nitrophenyl)ester |
| O,O-dimethyl O-3-nitrophenyl thiophosphate |
| Phosphorothioic acid,O,O-dimethyl O-(3-nitrophenyl) ester |