N1,N3-dip-tolylbenzene-1,3-diamine
N1,N3-dip-tolylbenzene-1,3-diamine structure
|
Common Name | N1,N3-dip-tolylbenzene-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 620-49-5 | Molecular Weight | 288.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N,N'-bis(4-methylphenyl)-1,3-benzenediamine (N1,N3-dip-tolylbenzene-1,3-diamine), Chinese name: N,N'-双(4-甲基苯基)-1,3-苯二胺, CAS number: 620-49-5, molecular formula: C20H20N2, molecular weight: 288.38600, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N'-bis(4-methylphenyl)-1,3-benzenediamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20N2 |
|---|---|
| Molecular Weight | 288.38600 |
| Exact Mass | 288.16300 |
| PSA | 24.06000 |
| LogP | 5.93660 |
| InChIKey | PIBIAJQNHWMGTD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2cccc(Nc3ccc(C)cc3)c2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2921590090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: SMILES notation of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is Cc1ccc(Nc2cccc(Nc3ccc(C)cc3)c2)cc1. |
| Q: What is the English name of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: The English name of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is N,N'-bis(4-methylphenyl)-1,3-benzenediamine. |
| Q: What is the InChIKey of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: InChIKey of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is PIBIAJQNHWMGTD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: Molecular formula of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is C20H20N2. |
| Q: What is the Chinese name of 620-49-5? |
| A: Chinese name of 620-49-5 is 620-49-5. |
| Q: What is the LogP of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: LogP of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is 5.93660. |
| Q: What is the polar surface area (PSA) of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: Polar surface area (PSA) of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is 24.06000. |
| Q: What is the CAS number of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: CAS number of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is 620-49-5. |
| Q: What is the molecular weight of N,N'-bis(4-methylphenyl)-1,3-benzenediamine? |
| A: Molecular weight of N,N'-bis(4-methylphenyl)-1,3-benzenediamine is 288.38600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |