3-Benzyl-benzoic Acid
3-Benzyl-benzoic Acid structure
|
Common Name | 3-Benzyl-benzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 620-54-2 | Molecular Weight | 212.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Benzyl-benzoic Acid (Chinese name: 3-苯基苯甲酸，CAS number: 620-54-2)，molecular formula: C14H12O2，molecular weight: 212.24400，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Benzyl-benzoic Acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12O2 |
|---|---|
| Molecular Weight | 212.24400 |
| Exact Mass | 212.08400 |
| PSA | 37.30000 |
| LogP | 2.97560 |
| InChIKey | WHUFYYNKCXXKSU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Cc2ccccc2)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:579-18-0
CAS#:35714-17-1
CAS#:35714-19-3
CAS#:74939-76-7
CAS#:4128-37-4
CAS#:1160842-98-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-benzylbenzoic acid |
| m-benzylbenzoic acid |
| 3-benzyl-benzoic acid |
| Diphenylmethan-carbonsaeure-(3) |
| 3-Benzyl-benzoesaeure |
| 3-(phenylmethyl)-benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Benzyl-benzoic Acid? |
| A: CAS number of 3-Benzyl-benzoic Acid is 620-54-2. |
| Q: What is the English name of 3-Benzyl-benzoic Acid? |
| A: The English name of 3-Benzyl-benzoic Acid is 3-Benzyl-benzoic Acid. |
| Q: What is the InChIKey of 3-Benzyl-benzoic Acid? |
| A: InChIKey of 3-Benzyl-benzoic Acid is WHUFYYNKCXXKSU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-Benzyl-benzoic Acid? |
| A: SMILES notation of 3-Benzyl-benzoic Acid is O=C(O)c1cccc(Cc2ccccc2)c1. |
| Q: What is the molecular weight of 3-Benzyl-benzoic Acid? |
| A: Molecular weight of 3-Benzyl-benzoic Acid is 212.24400. |
| Q: What is the Chinese name of 620-54-2? |
| A: Chinese name of 620-54-2 is 620-54-2. |
| Q: What is the LogP of 3-Benzyl-benzoic Acid? |
| A: LogP of 3-Benzyl-benzoic Acid is 2.97560. |
| Q: What is the polar surface area (PSA) of 3-Benzyl-benzoic Acid? |
| A: Polar surface area (PSA) of 3-Benzyl-benzoic Acid is 37.30000. |
| Q: What are the downstream products of 3-Benzyl-benzoic Acid? |
| A: Related downstream products(CAS) of 3-Benzyl-benzoic Acid: 579-18-0;35714-17-1;35714-19-3;74939-76-7;4128-37-4;1160842-98-7. |
| Q: What is the molecular formula of 3-Benzyl-benzoic Acid? |
| A: Molecular formula of 3-Benzyl-benzoic Acid is C14H12O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |