6-Amino-5-nitropyridine-3-sulfonic acid structure
|
Common Name | 6-Amino-5-nitropyridine-3-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 62009-38-5 | Molecular Weight | 219.17500 | |
| Density | 1.833 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H5N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Amino-5-nitropyridine-3-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.833 g/cm3 |
|---|---|
| Molecular Formula | C5H5N3O5S |
| Molecular Weight | 219.17500 |
| Exact Mass | 218.99500 |
| PSA | 147.48000 |
| LogP | 2.00390 |
| Index of Refraction | 1.667 |
| InChIKey | QUVFMPNHCPUDJB-UHFFFAOYSA-N |
| SMILES | Nc1ncc(S(=O)(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~%
6-Amino-5-nitro... CAS#:62009-38-5 |
| Literature: Journal of the American Chemical Society, , vol. 79, p. 6421,6423,6424 |
|
~%
6-Amino-5-nitro... CAS#:62009-38-5 |
| Literature: Journal of the American Chemical Society, , vol. 79, p. 6421,6423,6424 Roczniki Chemii, , vol. 34, p. 1149,1151 Chem.Abstr., , # 14448g |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-amino-5-nitro-pyridine-3-sulfonic acid |
| 2-Amino-3-nitro-pyridinsulfonsaeure-(5) |
| 6-Amino-5-nitro-3-pyridinesulfonicacid |
| 6-Amino-5-nitro-pyridin-3-sulfonsaeure |