1-methoxy-4-(4-methoxy-3-methylnaphthalen-1-yl)-2-methylnaphthalene structure
|
Common Name | 1-methoxy-4-(4-methoxy-3-methylnaphthalen-1-yl)-2-methylnaphthalene | ||
|---|---|---|---|---|
| CAS Number | 62012-55-9 | Molecular Weight | 342.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methoxy-4-(4-methoxy-3-methylnaphthalen-1-yl)-2-methylnaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H22O2 |
|---|---|
| Molecular Weight | 342.43000 |
| Exact Mass | 342.16200 |
| PSA | 18.46000 |
| LogP | 6.29400 |
| InChIKey | XFBVERWIKZMMRI-UHFFFAOYSA-N |
| SMILES | COc1c(C)cc(-c2cc(C)c(OC)c3ccccc23)c2ccccc12 |
|
~95%
1-methoxy-4-(4-... CAS#:62012-55-9 |
| Literature: McKillop, Alexander; Turrell, Andrew G.; Young, Derek W.; Taylor, Edward C. Journal of the American Chemical Society, 1980 , vol. 102, # 21 p. 6504 - 6512 |
| 1,1'-Binaphthalene,4,4'-dimethoxy-3,3'-dimethyl |
| 4,4'-Dimethoxy-3,3'-dimethyl-[1,1']binaphthyl |