2,2-dibromo-6-methoxy-1-indanone structure
|
Common Name | 2,2-dibromo-6-methoxy-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 62015-81-0 | Molecular Weight | 319.97700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dibromo-6-methoxy-1-indanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8Br2O2 |
|---|---|
| Molecular Weight | 319.97700 |
| Exact Mass | 317.88900 |
| PSA | 26.30000 |
| LogP | 2.92010 |
| InChIKey | QILPNBPBCDOCJU-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=O)C(Br)(Br)C2 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2-dibromo-2,3-dihydro-6-methoxy-1h-inden-1-one |