3-chloro-5-(2-furyl)-5-methyl-imidazolidine-2,4-dione structure
|
Common Name | 3-chloro-5-(2-furyl)-5-methyl-imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 62032-11-5 | Molecular Weight | 214.60600 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H7ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.60600 |
| Exact Mass | 214.01500 |
| PSA | 62.55000 |
| LogP | 1.46710 |
| Index of Refraction | 1.607 |
| InChIKey | WAZDKBPCRUXJLO-UHFFFAOYSA-N |
| SMILES | CC1(c2ccco2)NC(=O)N(Cl)C1=O |
|
~%
3-chloro-5-(2-f... CAS#:62032-11-5 |
| Literature: Rodgers,T.R. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 591 - 594 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-chloro-5-furan-2-yl-5-methyl-imidazolidine-2,4-dione |