1-(2,4-dimethoxy-6-methylphenyl)pentane-1,3-dione structure
|
Common Name | 1-(2,4-dimethoxy-6-methylphenyl)pentane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 62036-47-9 | Molecular Weight | 250.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4-dimethoxy-6-methylphenyl)pentane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O4 |
|---|---|
| Molecular Weight | 250.29000 |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 2.56410 |
| InChIKey | BLOKMGHGWCPNAS-UHFFFAOYSA-N |
| SMILES | CCC(=O)CC(=O)c1c(C)cc(OC)cc1OC |
|
~%
1-(2,4-dimethox... CAS#:62036-47-9 |
| Literature: Sethna; Shah Journal of the Indian Chemical Society, 1940 , vol. 17, p. 487,490 |
| 1,3-Pentanedione,1-(2,4-dimethoxy-6-methylphenyl) |
| 1-(2,4-dimethoxy-6-methyl-phenyl)-pentane-1,3-dione |
| 1-(2,4-Dimethoxy-6-methyl-phenyl)-pentan-1,3-dion |