(4'-Nitro-4-biphenylyl)methanol structure
|
Common Name | (4'-Nitro-4-biphenylyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 62037-99-4 | Molecular Weight | 229.231 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 417.2±33.0 °C at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | 165ºC | |
| MSDS | N/A | Flash Point | 179.4±13.8 °C | |
| Name | [4-(4-nitrophenyl)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 417.2±33.0 °C at 760 mmHg |
| Melting Point | 165ºC |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.231 |
| Flash Point | 179.4±13.8 °C |
| Exact Mass | 229.073898 |
| PSA | 66.05000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | MDUQVWINYYIMOQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(CO)cc2)cc1 |
| HS Code | 2906299090 |
|---|
|
~%
(4'-Nitro-4-bip... CAS#:62037-99-4 |
| Literature: Journal of Organometallic Chemistry, , vol. 117, p. 35 - 54 |
|
~%
(4'-Nitro-4-bip... CAS#:62037-99-4 |
| Literature: Journal of Organometallic Chemistry, , vol. 117, p. 35 - 54 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (4'-nitro[1,1'-biphenyl]-4-yl)methanol |
| 4'-Nitro-[1,1'-biphenyl]-4-methanol |
| 4-(4-Nitrophenyl)benzyl alcohol |
| (4'-Nitro-4-biphenylyl)methanol |
| [1,1'-Biphenyl]-4-methanol, 4'-nitro- |