trimethyl-[2-[[6-oxo-6-[2-(trimethylazaniumyl)ethylamino]hexanoyl]amino]ethyl]azanium,diiodide structure
|
Common Name | trimethyl-[2-[[6-oxo-6-[2-(trimethylazaniumyl)ethylamino]hexanoyl]amino]ethyl]azanium,diiodide | ||
|---|---|---|---|---|
| CAS Number | 62055-16-7 | Molecular Weight | 570.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H36I2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[2-[[6-oxo-6-[2-(trimethylazaniumyl)ethylamino]hexanoyl]amino]ethyl]azanium,diiodide |
|---|
| Molecular Formula | C16H36I2N4O2 |
|---|---|
| Molecular Weight | 570.29200 |
| Exact Mass | 570.09300 |
| PSA | 70.84000 |
| LogP | 3.61360 |
| InChIKey | UFQJLRLGHLHIIX-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCNC(=O)CCCCC(=O)NCC[N+](C)(C)C.[I-].[I-] |
|
~%
trimethyl-[2-[[... CAS#:62055-16-7 |
| Literature: Phillips Journal of the American Chemical Society, 1951 , vol. 73, p. 5822 |