1-(3'-bromo-3'-deoxyarabinofuranosyl)uracil structure
|
Common Name | 1-(3'-bromo-3'-deoxyarabinofuranosyl)uracil | ||
|---|---|---|---|---|
| CAS Number | 6206-18-4 | Molecular Weight | 218.24600 | |
| Density | 1.882g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H15NaO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,heptanal,hydrogen sulfite |
|---|---|
| Synonym | More Synonyms |
| Density | 1.882g/cm3 |
|---|---|
| Molecular Formula | C7H15NaO4S |
| Molecular Weight | 218.24600 |
| Exact Mass | 218.05900 |
| PSA | 96.64000 |
| LogP | 2.35990 |
| Index of Refraction | 1.641 |
| InChIKey | XMOJQZGVVRHTMQ-CCXZUQQUSA-N |
| SMILES | O=c1ccn(C2OC(CO)C(Br)C2O)c(=O)[nH]1 |
| Heptyl aldehyde sodium bisulfite |
| Hepbisul |
| Heptanal,compd. with sulfurous acid monosodium salt (1:1) |
| sodium hydrogen sulfite-heptanal(1:1:1) |