4-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane structure
|
Common Name | 4-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane | ||
|---|---|---|---|---|
| CAS Number | 62060-23-5 | Molecular Weight | 238.73200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chlorosulfonyloxy-7,7-dimethylbicyclo[2.2.1]heptane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H15ClO3S |
|---|---|
| Molecular Weight | 238.73200 |
| Exact Mass | 238.04300 |
| PSA | 51.75000 |
| LogP | 3.53620 |
| InChIKey | XAGWUEKADIFAHI-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CCC1(OS(=O)(=O)Cl)CC2 |
|
~%
4-chlorosulfony... CAS#:62060-23-5 |
| Literature: Takeuchi,K. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2205 - 2206 |
| Chlorosulfuric acid,7,7-dimethylbicyclo[2.2.1]hept-1-yl ester |