1,8-dibromo-4,5-bis(methylamino)anthracene-9,10-dione structure
|
Common Name | 1,8-dibromo-4,5-bis(methylamino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 62062-72-0 | Molecular Weight | 424.08700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12Br2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,8-dibromo-4,5-bis(methylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12Br2N2O2 |
|---|---|
| Molecular Weight | 424.08700 |
| Exact Mass | 421.92700 |
| PSA | 58.20000 |
| LogP | 4.21640 |
| InChIKey | DHHMIZCURSKKQM-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Br)c2c1C(=O)c1c(NC)ccc(Br)c1C2=O |
|
~%
1,8-dibromo-4,5... CAS#:62062-72-0 |
| Literature: Hall; Hey Journal of the Chemical Society, 1948 , p. 736,738 |
| 9,10-Anthracenedione,1,8-dibromo-4,5-bis(methylamino) |